Aminobenzoic acids and derivatives
Aobchem 2-Fluoro-3 4-dimethylbenzoic acid | ≥95% | CAS 1427391-29-4 | C9H9FO2 | 500mg
2-Fluoro-3 4-dimethylbenzoic acid | ≥95% | CAS 1427391-29-4 | C9H9FO2 | 500mg
Aobchem Ethyl 4-bromo-2 6-dimethylbenzoate | ≥97% | CAS 1807169-47-6 | C11H13BrO2 | 500mg
Ethyl 4-bromo-2 6-dimethylbenzoate | ≥97% | CAS 1807169-47-6 | C11H13BrO2 | 500mg
Aobchem 2-Fluoro-3-hydroxy-4-methoxybenzaldehyde | ≥97% | CAS 79418-73-8 | C8H7FO3 | 1g
2-Fluoro-3-hydroxy-4-methoxybenzaldehyde | ≥97% | CAS 79418-73-8 | C8H7FO3 | 1g
Aobchem 3-Chloro-5-hydroxy-4-methoxybenzoic acid | 95% | CAS 80547-63-3 | C8H7ClO4 | 500mg
3-Chloro-5-hydroxy-4-methoxybenzoic acid | 95% | CAS 80547-63-3 | C8H7ClO4 | 500mg
Aobchem 3-Bromo-2-chloro-5-methylbenzoic acid | ≥97% | CAS 154257-78-0 | C8H6BrClO2 | 500mg
3-Bromo-2-chloro-5-methylbenzoic acid | ≥97% | CAS 154257-78-0 | C8H6BrClO2 | 500mg
Aobchem Benzoic acid 4-(2-methyl-1-oxopropyl)- 1 1-dimethylethyl ester | 95% | CAS 2946682-45-5 | C15H20O3 | 500mg
Benzoic acid 4-(2-methyl-1-oxopropyl)- 1 1-dimethylethyl ester | 95% | CAS 2946682-45-5 | C15H20O3 | 500mg
Medchemexpress LLC Kushenol A | 99217-63-7 | 1 ML
Kushenol A (Leachianone E) is a flavonoid antioxidant isolated from the root of Sophora flavescent. This compound acts as a non-competitive tyrosinase inhibitor, blocking the conversion of L-tyrosine to L-DOPA. It also shows inhibitory effects on alpha-glucosidase and β-amylase, making it a potential candidate for cosmetic applications in skin whitening and anti-aging.
- Isolated from the root of Sophora flavescent
- Non-competitive tyrosinase inhibitor
- Blocks conversion of L-tyrosine to L-DOPA
- Flavonoid antioxidant
- Inhibits alpha-glucosidase and β-amylase
- Potential for skin whitening and anti-aging applications
- Highly potent inhibitory activity on ABTS•+ radical scavenging
- Exhibits cytotoxic effects against NSCLC cells
eMolecules 126705-22-4 | Fmoc-1-aminocyclopropane-1-carboxylic acid | Chem-Impex | MFCD00190873 | 323.348 | C19H17NO4 | 99.000 | OC(=O)C1(CC1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 25g | 205000538
Fmoc-1-aminocyclopropane-1-carboxylic acid | Chem-Impex | 126705-22-4 | MFCD00190873 | 323.348 | C19H17NO4 | 99.000 | OC(=O)C1(CC1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 25g | 205000538
Aobchem 3-Bromo-2-fluoro-6-methylbenzoic acid | ≥97% | CAS 1427433-22-4 | C8H6BrFO2 | 250mg
3-Bromo-2-fluoro-6-methylbenzoic acid | ≥97% | CAS 1427433-22-4 | C8H6BrFO2 | 250mg
Aobchem 2 3 6-Trichloroisonicotinic acid | 97% | CAS 2764733-80-2 | C6H2Cl3NO2 | 5g
2 3 6-Trichloroisonicotinic acid | 97% | CAS 2764733-80-2 | C6H2Cl3NO2 | 5g
Aobchem 4-Bromo-7-methylbenzo[b]thiophene | 95% | CAS 87924-78-5 | C9H7BrS | 250mg
4-Bromo-7-methylbenzo[b]thiophene | 95% | CAS 87924-78-5 | C9H7BrS | 250mg
Aobchem 3 4-Dibromo-5-methylbenzoic acid | ≥97% | CAS 1564638-18-1 | C8H6Br2O2 | 250mg
3 4-Dibromo-5-methylbenzoic acid | ≥97% | CAS 1564638-18-1 | C8H6Br2O2 | 250mg
Aobchem Benzoic acid 4-(2-bromoethoxy)- methyl ester | ≥95% | CAS 56850-91-0 | C10H11BrO3 | 5g
Benzoic acid 4-(2-bromoethoxy)- methyl ester | ≥95% | CAS 56850-91-0 | C10H11BrO3 | 5g
Chemscene 2-Deoxy-2 2-difluoro-D-erythro-pentonic acid -Lactone 3 5-dibenzoate | 25g | CS-0031397 | 97% | 122111-01-7 | MFCD08458308 | 376 31 | C19H14F2O6
Chemscene | 2-Deoxy-2 2-difluoro-D-erythro-pentonic acid -Lactone 3 5-dibenzoate | 25g | CS-0031397 | 97% | 122111-01-7 | MFCD08458308 | 376 31 | C19H14F2O6
Aobchem Benzoic acid 4-(2-bromoethoxy)- methyl ester | ≥95% | CAS 56850-91-0 | C10H11BrO3 | 1g
Benzoic acid 4-(2-bromoethoxy)- methyl ester | ≥95% | CAS 56850-91-0 | C10H11BrO3 | 1g